C21H33NO4 — CID 68836892
ethanol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid (PubChem CID 68836892) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is ethanol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid.
| Compound Name | ethanol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 68836892 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | ethanol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid |
| SMILES | CC(C)C1CCC(C(=O)N[C@H](Cc2ccccc2)C(=O)O)CC1.CCO |
| InChI | InChI=1S/C19H27NO3.C2H6O/c1-13(2)15-8-10-16(11-9-15)18(21)20-17(19(22)23)12-14-6-4-3-5-7-14;1-2-3/h3-7,13,15-17H,8-12H2,1-2H3,(H,20,21)(H,22,23);3H,2H2,1H3/t15?,16?,17-;/m1./s1 |
| InChIKey | QYDNGHZILUTZLM-UKCDPNGZSA-N |
| XLogP | 3.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |