C28H36N2O4 — CID 10139735
[(2S)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoyl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 10139735) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is [(2S)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoyl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [(2S)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoyl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 10139735 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | [(2S)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoyl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | CC(C)C1CCC(C(=O)N[C@@H](Cc2ccccc2)C(=O)OC(=O)[C@@H](N)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H36N2O4/c1-19(2)22-13-15-23(16-14-22)26(31)30-25(18-21-11-7-4-8-12-21)28(33)34-27(32)24(29)17-20-9-5-3-6-10-20/h3-12,19,22-25H,13-18,29H2,1-2H3,(H,30,31)/t22?,23?,24-,25-/m0/s1 |
| InChIKey | AKHCDDNOKUTTCI-OVKIHRCZSA-N |
| XLogP | 3.82 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|