C27H34N2O6 — CID 118726960
[3-(nitrooxymethyl)phenyl]methyl (2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate (PubChem CID 118726960) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl]methyl (2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate.
| Compound Name | [3-(nitrooxymethyl)phenyl]methyl (2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate |
|---|---|
| PubChem CID | 118726960 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl]methyl (2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate |
| SMILES | CC(C)C1CCC(C(=O)N[C@H](Cc2ccccc2)C(=O)OCc2cccc(CO[N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C27H34N2O6/c1-19(2)23-11-13-24(14-12-23)26(30)28-25(16-20-7-4-3-5-8-20)27(31)34-17-21-9-6-10-22(15-21)18-35-29(32)33/h3-10,15,19,23-25H,11-14,16-18H2,1-2H3,(H,28,30)/t23?,24?,25-/m1/s1 |
| InChIKey | IAGZSMWIWFZJFZ-DDJHWDJXSA-N |
| XLogP | 4.63 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|