C26H36N2O9 — CID 67447485
[(Z)-4-(1-nitrooxyethoxycarbonyloxy)but-2-enyl] 3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate (PubChem CID 67447485) has the molecular formula C26H36N2O9 and a molecular weight of 520.58 g/mol. Its IUPAC name is [(Z)-4-(1-nitrooxyethoxycarbonyloxy)but-2-enyl] 3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate.
| Compound Name | [(Z)-4-(1-nitrooxyethoxycarbonyloxy)but-2-enyl] 3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate |
|---|---|
| PubChem CID | 67447485 |
| Molecular Formula | C26H36N2O9 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | [(Z)-4-(1-nitrooxyethoxycarbonyloxy)but-2-enyl] 3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoate |
| SMILES | CC(OC(=O)OC/C=C\COC(=O)C(Cc1ccccc1)NC(=O)C1CCC(C(C)C)CC1)O[N+](=O)[O-] |
| InChI | InChI=1S/C26H36N2O9/c1-18(2)21-11-13-22(14-12-21)24(29)27-23(17-20-9-5-4-6-10-20)25(30)34-15-7-8-16-35-26(31)36-19(3)37-28(32)33/h4-10,18-19,21-23H,11-17H2,1-3H3,(H,27,29)/b8-7- |
| InChIKey | PZUUYJYDQDKOSC-FPLPWBNLSA-N |
| XLogP | 3.98 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|