C26H44N2O8 — CID 10311467
(2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid (PubChem CID 10311467) has the molecular formula C26H44N2O8 and a molecular weight of 512.64 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid.
| Compound Name | (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 10311467 |
| Molecular Formula | C26H44N2O8 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.31 |
| IUPAC Name | (2R,3R,4R,5S)-6-(methylamino)hexane-1,2,3,4,5-pentol;(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propanoic acid |
| SMILES | CC(C)C1CCC(C(=O)N[C@H](Cc2ccccc2)C(=O)O)CC1.CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C19H27NO3.C7H17NO5/c1-13(2)15-8-10-16(11-9-15)18(21)20-17(19(22)23)12-14-6-4-3-5-7-14;1-8-2-4(10)6(12)7(13)5(11)3-9/h3-7,13,15-17H,8-12H2,1-2H3,(H,20,21)(H,22,23);4-13H,2-3H2,1H3/t15?,16?,17-;4-,5+,6+,7+/m10/s1 |
| InChIKey | CFOHJUOXYQVYRW-LASXNPEDSA-N |
| XLogP | -0.10 |
| TPSA | 179.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |