C21H28Cl3NO3 — CID 121307792
[(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propyl] 2,2,2-trichloroacetate (PubChem CID 121307792) has the molecular formula C21H28Cl3NO3 and a molecular weight of 448.82 g/mol. Its IUPAC name is [(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propyl] 2,2,2-trichloroacetate.
| Compound Name | [(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propyl] 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 121307792 |
| Molecular Formula | C21H28Cl3NO3 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [(2R)-3-phenyl-2-[(4-propan-2-ylcyclohexanecarbonyl)amino]propyl] 2,2,2-trichloroacetate |
| SMILES | CC(C)C1CCC(C(=O)N[C@@H](COC(=O)C(Cl)(Cl)Cl)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H28Cl3NO3/c1-14(2)16-8-10-17(11-9-16)19(26)25-18(12-15-6-4-3-5-7-15)13-28-20(27)21(22,23)24/h3-7,14,16-18H,8-13H2,1-2H3,(H,25,26)/t16?,17?,18-/m1/s1 |
| InChIKey | JZPRTRDTKUOVDK-DAWZGUTISA-N |
| XLogP | 5.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|