C18H22O4 — CID 69478159
[(3S)-1-(2-hydroxy-4-oxocyclopentyl)-5-phenylpent-1-en-3-yl] acetate (PubChem CID 69478159) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(3S)-1-(2-hydroxy-4-oxocyclopentyl)-5-phenylpent-1-en-3-yl] acetate.
| Compound Name | [(3S)-1-(2-hydroxy-4-oxocyclopentyl)-5-phenylpent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 69478159 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(3S)-1-(2-hydroxy-4-oxocyclopentyl)-5-phenylpent-1-en-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C=CC1CC(=O)CC1O)CCc1ccccc1 |
| InChI | InChI=1S/C18H22O4/c1-13(19)22-17(9-7-14-5-3-2-4-6-14)10-8-15-11-16(20)12-18(15)21/h2-6,8,10,15,17-18,21H,7,9,11-12H2,1H3/t15?,17-,18?/m0/s1 |
| InChIKey | QMJDZVGMOKBRND-NXYGQSRBSA-N |
| XLogP | 2.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|