C18H22O5 — CID 140517335
[(2S,3S)-3-hydroxy-2-[(Z)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate (PubChem CID 140517335) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(2S,3S)-3-hydroxy-2-[(Z)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate.
| Compound Name | [(2S,3S)-3-hydroxy-2-[(Z)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate |
|---|---|
| PubChem CID | 140517335 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(2S,3S)-3-hydroxy-2-[(Z)-1-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl] acetate |
| SMILES | CC(=O)OC1C(=O)C[C@H](O)[C@@H]1/C(O)=C/CCCc1ccccc1 |
| InChI | InChI=1S/C18H22O5/c1-12(19)23-18-16(22)11-15(21)17(18)14(20)10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,10,15,17-18,20-21H,5-6,9,11H2,1H3/b14-10-/t15-,17-,18?/m0/s1 |
| InChIKey | BTVOBBGQJIIVJS-HEVSAUHKSA-N |
| XLogP | 2.33 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|