C11H12F2 — CID 15268524
5,5-difluoropent-4-enylbenzene (PubChem CID 15268524) has the molecular formula C11H12F2 and a molecular weight of 182.21 g/mol. Its IUPAC name is 5,5-difluoropent-4-enylbenzene.
| Compound Name | 5,5-difluoropent-4-enylbenzene |
|---|---|
| PubChem CID | 15268524 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5,5-difluoropent-4-enylbenzene |
| SMILES | FC(F)=CCCCc1ccccc1 |
| InChI | InChI=1S/C11H12F2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7,9H,4-5,8H2 |
| InChIKey | QOQQCKCVGBRPGV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|