C12H12F2 — CID 14665877
[(3E)-6,6-difluorohexa-3,5-dienyl]benzene (PubChem CID 14665877) has the molecular formula C12H12F2 and a molecular weight of 194.22 g/mol. Its IUPAC name is [(3E)-6,6-difluorohexa-3,5-dienyl]benzene.
| Compound Name | [(3E)-6,6-difluorohexa-3,5-dienyl]benzene |
|---|---|
| PubChem CID | 14665877 |
| Molecular Formula | C12H12F2 |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | [(3E)-6,6-difluorohexa-3,5-dienyl]benzene |
| SMILES | FC(F)=C/C=C/CCc1ccccc1 |
| InChI | InChI=1S/C12H12F2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h1-4,6-8,10H,5,9H2/b6-2+ |
| InChIKey | UWGLCRRVKYKVBK-QHHAFSJGSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|