C16H18O4 — CID 88730717
(2E,4E)-2-ethoxycarbonyl-7-phenylhepta-2,4-dienoic acid (PubChem CID 88730717) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2E,4E)-2-ethoxycarbonyl-7-phenylhepta-2,4-dienoic acid.
| Compound Name | (2E,4E)-2-ethoxycarbonyl-7-phenylhepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88730717 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2E,4E)-2-ethoxycarbonyl-7-phenylhepta-2,4-dienoic acid |
| SMILES | CCOC(=O)/C(=C/C=C/CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H18O4/c1-2-20-16(19)14(15(17)18)12-8-4-7-11-13-9-5-3-6-10-13/h3-6,8-10,12H,2,7,11H2,1H3,(H,17,18)/b8-4+,14-12+ |
| InChIKey | GIARNTCWSICATK-RRJQSJTRSA-N |
| XLogP | 2.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|