C14H16F2OS — CID 11651932
S-(6,6-difluorohex-5-enyl) 2-phenylethanethioate (PubChem CID 11651932) has the molecular formula C14H16F2OS and a molecular weight of 270.34 g/mol. Its IUPAC name is S-(6,6-difluorohex-5-enyl) 2-phenylethanethioate.
| Compound Name | S-(6,6-difluorohex-5-enyl) 2-phenylethanethioate |
|---|---|
| PubChem CID | 11651932 |
| Molecular Formula | C14H16F2OS |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | S-(6,6-difluorohex-5-enyl) 2-phenylethanethioate |
| SMILES | O=C(Cc1ccccc1)SCCCCC=C(F)F |
| InChI | InChI=1S/C14H16F2OS/c15-13(16)9-5-2-6-10-18-14(17)11-12-7-3-1-4-8-12/h1,3-4,7-9H,2,5-6,10-11H2 |
| InChIKey | XQZHDXAQWDJZCH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|