C23H30N4O3 — CID 70524613
(2R,3S,4R)-4-hydroxy-3-(1-hydroxy-5-phenylpent-1-enyl)-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one (PubChem CID 70524613) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is (2R,3S,4R)-4-hydroxy-3-(1-hydroxy-5-phenylpent-1-enyl)-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one.
| Compound Name | (2R,3S,4R)-4-hydroxy-3-(1-hydroxy-5-phenylpent-1-enyl)-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70524613 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (2R,3S,4R)-4-hydroxy-3-(1-hydroxy-5-phenylpent-1-enyl)-2-[(Z)-6-(2H-tetrazol-5-yl)hex-2-enyl]cyclopentan-1-one |
| SMILES | O=C1C[C@@H](O)[C@@H](C(O)=CCCCc2ccccc2)[C@H]1C/C=C\CCCc1nn[nH]n1 |
| InChI | InChI=1S/C23H30N4O3/c28-19(14-9-8-12-17-10-4-3-5-11-17)23-18(20(29)16-21(23)30)13-6-1-2-7-15-22-24-26-27-25-22/h1,3-6,10-11,14,18,21,23,28,30H,2,7-9,12-13,15-16H2,(H,24,25,26,27)/b6-1-,19-14?/t18-,21+,23+/m0/s1 |
| InChIKey | QXLWUFJNCWJBNJ-ZZIBNVOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|