C29H44O4Si — CID 67771496
(Z)-7-[2-[1-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid (PubChem CID 67771496) has the molecular formula C29H44O4Si and a molecular weight of 484.75 g/mol. Its IUPAC name is (Z)-7-[2-[1-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[2-[1-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 67771496 |
| Molecular Formula | C29H44O4Si |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | (Z)-7-[2-[1-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-5-hydroxycyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(=CCCCc1ccccc1)C1=CCC(O)C1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C29H44O4Si/c1-29(2,3)34(4,5)33-27(19-14-13-17-23-15-9-8-10-16-23)25-21-22-26(30)24(25)18-11-6-7-12-20-28(31)32/h6,8-11,15-16,19,21,24,26,30H,7,12-14,17-18,20,22H2,1-5H3,(H,31,32)/b11-6-,27-19? |
| InChIKey | MQUBOWZHULVMGJ-TUOFMIPHSA-N |
| XLogP | 7.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|