C21H30O6 — CID 70185797
(Z)-7-[(3R,5S)-2-[(E)-5-(furan-3-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 70185797) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is (Z)-7-[(3R,5S)-2-[(E)-5-(furan-3-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(3R,5S)-2-[(E)-5-(furan-3-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70185797 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (Z)-7-[(3R,5S)-2-[(E)-5-(furan-3-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\CC1C(/C(O)=C\CCCc2ccoc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C21H30O6/c22-17(9-6-5-7-15-11-12-27-14-15)21-16(18(23)13-19(21)24)8-3-1-2-4-10-20(25)26/h1,3,9,11-12,14,16,18-19,21-24H,2,4-8,10,13H2,(H,25,26)/b3-1-,17-9+/t16?,18-,19+,21?/m0/s1 |
| InChIKey | SEYYMBRUZOCSDI-FGPCSCBBSA-N |
| XLogP | 3.60 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|