C16H22O6 — CID 70608011
2-[(1R,2R,3R,5S)-2-[5-(furan-2-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]acetic acid (PubChem CID 70608011) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-2-[5-(furan-2-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-2-[5-(furan-2-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70608011 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-2-[5-(furan-2-yl)-1-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(O)=CCCCc2ccco2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C16H22O6/c17-12(6-2-1-4-10-5-3-7-22-10)16-11(8-15(20)21)13(18)9-14(16)19/h3,5-7,11,13-14,16-19H,1-2,4,8-9H2,(H,20,21)/t11-,13-,14+,16-/m0/s1 |
| InChIKey | FIFSGNYRCIWJRF-ZIEJDFEHSA-N |
| XLogP | 1.88 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|