C24H26O7 — CID 70570230
2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)cyclopentyl]acetic acid (PubChem CID 70570230) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70570230 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-3-benzoyloxy-5-hydroxy-2-(1-hydroxy-4-phenoxybut-1-enyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](C(O)=CCCOc2ccccc2)[C@H](OC(=O)c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C24H26O7/c25-19(12-7-13-30-17-10-5-2-6-11-17)23-18(14-22(27)28)20(26)15-21(23)31-24(29)16-8-3-1-4-9-16/h1-6,8-12,18,20-21,23,25-26H,7,13-15H2,(H,27,28)/t18-,20-,21+,23-/m0/s1 |
| InChIKey | FPDIHWCXVUUPAC-DXKRWKNPSA-N |
| XLogP | 3.59 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|