C22H28O6 — CID 70620147
2-[(1R,2R,3S,5S)-3-benzoyloxy-5-hydroxy-2-(3-oxooct-1-enyl)cyclopentyl]acetic acid (PubChem CID 70620147) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[(1R,2R,3S,5S)-3-benzoyloxy-5-hydroxy-2-(3-oxooct-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3S,5S)-3-benzoyloxy-5-hydroxy-2-(3-oxooct-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70620147 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 2-[(1R,2R,3S,5S)-3-benzoyloxy-5-hydroxy-2-(3-oxooct-1-enyl)cyclopentyl]acetic acid |
| SMILES | CCCCCC(=O)C=C[C@@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O6/c1-2-3-5-10-16(23)11-12-17-18(13-21(25)26)19(24)14-20(17)28-22(27)15-8-6-4-7-9-15/h4,6-9,11-12,17-20,24H,2-3,5,10,13-14H2,1H3,(H,25,26)/t17-,18-,19+,20+/m1/s1 |
| InChIKey | PQUDQEDJNZTWLX-ZRNYENFQSA-N |
| XLogP | 3.39 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|