C23H30O5 — CID 142097253
2-[(1R)-2-[(E)-3-oxooct-1-enyl]-3-phenacyloxycyclopentyl]acetic acid (PubChem CID 142097253) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[(1R)-2-[(E)-3-oxooct-1-enyl]-3-phenacyloxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R)-2-[(E)-3-oxooct-1-enyl]-3-phenacyloxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 142097253 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[(1R)-2-[(E)-3-oxooct-1-enyl]-3-phenacyloxycyclopentyl]acetic acid |
| SMILES | CCCCCC(=O)/C=C/C1C(OCC(=O)c2ccccc2)CC[C@@H]1CC(=O)O |
| InChI | InChI=1S/C23H30O5/c1-2-3-5-10-19(24)12-13-20-18(15-23(26)27)11-14-22(20)28-16-21(25)17-8-6-4-7-9-17/h4,6-9,12-13,18,20,22H,2-3,5,10-11,14-16H2,1H3,(H,26,27)/b13-12+/t18-,20?,22?/m1/s1 |
| InChIKey | ZEGCRLYDGVPREL-QGPBRLSKSA-N |
| XLogP | 4.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|