C20H26N2O4 — CID 56976613
[3-methyl-2-oxo-5-(3-oxooct-1-enyl)imidazolidin-1-yl]methyl benzoate (PubChem CID 56976613) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is [3-methyl-2-oxo-5-(3-oxooct-1-enyl)imidazolidin-1-yl]methyl benzoate.
| Compound Name | [3-methyl-2-oxo-5-(3-oxooct-1-enyl)imidazolidin-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 56976613 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [3-methyl-2-oxo-5-(3-oxooct-1-enyl)imidazolidin-1-yl]methyl benzoate |
| SMILES | CCCCCC(=O)C=CC1CN(C)C(=O)N1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O4/c1-3-4-6-11-18(23)13-12-17-14-21(2)20(25)22(17)15-26-19(24)16-9-7-5-8-10-16/h5,7-10,12-13,17H,3-4,6,11,14-15H2,1-2H3 |
| InChIKey | UCADEOBJPUKAJI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|