C20H26N2O5 — CID 54179656
benzoyl 5-(3-hydroxyoct-1-enyl)-3-methyl-2-oxoimidazolidine-1-carboxylate (PubChem CID 54179656) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is benzoyl 5-(3-hydroxyoct-1-enyl)-3-methyl-2-oxoimidazolidine-1-carboxylate.
| Compound Name | benzoyl 5-(3-hydroxyoct-1-enyl)-3-methyl-2-oxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 54179656 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | benzoyl 5-(3-hydroxyoct-1-enyl)-3-methyl-2-oxoimidazolidine-1-carboxylate |
| SMILES | CCCCCC(O)C=CC1CN(C)C(=O)N1C(=O)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O5/c1-3-4-6-11-17(23)13-12-16-14-21(2)19(25)22(16)20(26)27-18(24)15-9-7-5-8-10-15/h5,7-10,12-13,16-17,23H,3-4,6,11,14H2,1-2H3 |
| InChIKey | PAXHIBNYYHUSPR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|