C21H29NO4 — CID 91264780
4-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-3-oxopyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 91264780) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-3-oxopyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-3-oxopyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 91264780 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 4-[2-[(2R)-2-[(3S)-3-hydroxyoct-1-enyl]-3-oxopyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1C(=O)CCN1CCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H29NO4/c1-2-3-4-5-18(23)10-11-19-20(24)13-15-22(19)14-12-16-6-8-17(9-7-16)21(25)26/h6-11,18-19,23H,2-5,12-15H2,1H3,(H,25,26)/t18-,19+/m0/s1 |
| InChIKey | DNJSVIDPJLQEOG-RBUKOAKNSA-N |
| XLogP | 3.07 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|