C25H36O4 — CID 142840938
4-[4-[(5R)-5-[(E)-3-hydroxyoct-1-enyl]-2-oxocyclohexyl]butyl]benzoic acid (PubChem CID 142840938) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 4-[4-[(5R)-5-[(E)-3-hydroxyoct-1-enyl]-2-oxocyclohexyl]butyl]benzoic acid.
| Compound Name | 4-[4-[(5R)-5-[(E)-3-hydroxyoct-1-enyl]-2-oxocyclohexyl]butyl]benzoic acid |
|---|---|
| PubChem CID | 142840938 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 4-[4-[(5R)-5-[(E)-3-hydroxyoct-1-enyl]-2-oxocyclohexyl]butyl]benzoic acid |
| SMILES | CCCCCC(O)/C=C/[C@@H]1CCC(=O)C(CCCCc2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C25H36O4/c1-2-3-4-9-23(26)16-12-20-13-17-24(27)22(18-20)8-6-5-7-19-10-14-21(15-11-19)25(28)29/h10-12,14-16,20,22-23,26H,2-9,13,17-18H2,1H3,(H,28,29)/b16-12+/t20-,22?,23?/m1/s1 |
| InChIKey | WTTTUDDWGCXQIH-SKJWYPQKSA-N |
| XLogP | 5.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|