C29H45NO4 — CID 3664333
7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[2-(4-methoxyphenyl)ethyl]heptanamide (PubChem CID 3664333) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is 7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[2-(4-methoxyphenyl)ethyl]heptanamide.
| Compound Name | 7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[2-(4-methoxyphenyl)ethyl]heptanamide |
|---|---|
| PubChem CID | 3664333 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[2-(4-methoxyphenyl)ethyl]heptanamide |
| SMILES | CCCCCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)NCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H45NO4/c1-3-4-7-10-25(31)17-15-24-16-20-28(32)27(24)11-8-5-6-9-12-29(33)30-22-21-23-13-18-26(34-2)19-14-23/h13-15,17-19,24-25,27,31H,3-12,16,20-22H2,1-2H3,(H,30,33) |
| InChIKey | RIXBDEMMKVCRIM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|