C33H52N2O7 — CID 163153226
N-hydroxy-4-[[2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]-4-methylpentanoyl]oxymethyl]benzeneamine oxide (PubChem CID 163153226) has the molecular formula C33H52N2O7 and a molecular weight of 588.79 g/mol. Its IUPAC name is N-hydroxy-4-[[2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]-4-methylpentanoyl]oxymethyl]benzeneamine oxide.
| Compound Name | N-hydroxy-4-[[2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]-4-methylpentanoyl]oxymethyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163153226 |
| Molecular Formula | C33H52N2O7 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | N-hydroxy-4-[[2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]-4-methylpentanoyl]oxymethyl]benzeneamine oxide |
| SMILES | CCCCCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)NC(CC(C)C)C(=O)OCc1ccc([NH+]([O-])O)cc1 |
| InChI | InChI=1S/C33H52N2O7/c1-4-5-8-11-28(36)20-16-26-17-21-31(37)29(26)12-9-6-7-10-13-32(38)34-30(22-24(2)3)33(39)42-23-25-14-18-27(19-15-25)35(40)41/h14-16,18-20,24,26,28-30,35-36,40H,4-13,17,21-23H2,1-3H3,(H,34,38) |
| InChIKey | ODEJNHZIOMZZRA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|