C26H45NO5 — CID 25425026
(2R,3R)-2-[7-[(1R,2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoylamino]-3-methylpentanoic acid (PubChem CID 25425026) has the molecular formula C26H45NO5 and a molecular weight of 451.65 g/mol. Its IUPAC name is (2R,3R)-2-[7-[(1R,2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoylamino]-3-methylpentanoic acid.
| Compound Name | (2R,3R)-2-[7-[(1R,2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 25425026 |
| Molecular Formula | C26H45NO5 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | (2R,3R)-2-[7-[(1R,2R)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoylamino]-3-methylpentanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)N[C@@H](C(=O)O)[C@H](C)CC |
| InChI | InChI=1S/C26H45NO5/c1-4-6-9-12-21(28)17-15-20-16-18-23(29)22(20)13-10-7-8-11-14-24(30)27-25(26(31)32)19(3)5-2/h15,17,19-22,25,28H,4-14,16,18H2,1-3H3,(H,27,30)(H,31,32)/b17-15+/t19-,20+,21+,22-,25-/m1/s1 |
| InChIKey | JHROCXRVEIGATO-DFZWZFLDSA-N |
| XLogP | 5.04 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|