C22H41O5P — CID 22808740
trans-(2R,3R)-2-(7-dimethoxyphosphorylheptyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one (PubChem CID 22808740) has the molecular formula C22H41O5P and a molecular weight of 416.54 g/mol. Its IUPAC name is trans-(2R,3R)-2-(7-dimethoxyphosphorylheptyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-2-(7-dimethoxyphosphorylheptyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 22808740 |
| Molecular Formula | C22H41O5P |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | trans-(2R,3R)-2-(7-dimethoxyphosphorylheptyl)-3-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentan-1-one |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCCCP(=O)(OC)OC |
| InChI | InChI=1S/C22H41O5P/c1-4-5-9-12-20(23)16-14-19-15-17-22(24)21(19)13-10-7-6-8-11-18-28(25,26-2)27-3/h14,16,19-21,23H,4-13,15,17-18H2,1-3H3/b16-14+/t19-,20-,21+/m0/s1 |
| InChIKey | MOERXGZBAYBPTH-SGRRYWTJSA-N |
| XLogP | 5.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|