C30H51NO3 — CID 3734923
3-(3-hydroxyoct-1-enyl)-2-[7-oxo-7-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)heptyl]cyclopentan-1-one (PubChem CID 3734923) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is 3-(3-hydroxyoct-1-enyl)-2-[7-oxo-7-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)heptyl]cyclopentan-1-one.
| Compound Name | 3-(3-hydroxyoct-1-enyl)-2-[7-oxo-7-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)heptyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 3734923 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | 3-(3-hydroxyoct-1-enyl)-2-[7-oxo-7-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)heptyl]cyclopentan-1-one |
| SMILES | CCCCCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)N1CC2(C)CC1CC(C)(C)C2 |
| InChI | InChI=1S/C30H51NO3/c1-5-6-9-12-25(32)17-15-23-16-18-27(33)26(23)13-10-7-8-11-14-28(34)31-22-30(4)20-24(31)19-29(2,3)21-30/h15,17,23-26,32H,5-14,16,18-22H2,1-4H3 |
| InChIKey | AKGZGYCPEILHJF-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|