C24H41NO6 — CID 3369543
methyl 3-hydroxy-2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]propanoate (PubChem CID 3369543) has the molecular formula C24H41NO6 and a molecular weight of 439.59 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]propanoate.
| Compound Name | methyl 3-hydroxy-2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]propanoate |
|---|---|
| PubChem CID | 3369543 |
| Molecular Formula | C24H41NO6 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | methyl 3-hydroxy-2-[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]propanoate |
| SMILES | CCCCCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)NC(CO)C(=O)OC |
| InChI | InChI=1S/C24H41NO6/c1-3-4-7-10-19(27)15-13-18-14-16-22(28)20(18)11-8-5-6-9-12-23(29)25-21(17-26)24(30)31-2/h13,15,18-21,26-27H,3-12,14,16-17H2,1-2H3,(H,25,29) |
| InChIKey | XDFZRFBIZJREOQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|