C28H47NO5 — CID 3487933
4-[[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 3487933) has the molecular formula C28H47NO5 and a molecular weight of 477.69 g/mol. Its IUPAC name is 4-[[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 3487933 |
| Molecular Formula | C28H47NO5 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.35 |
| IUPAC Name | 4-[[7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCCCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C28H47NO5/c1-2-3-6-9-24(30)18-16-22-17-19-26(31)25(22)10-7-4-5-8-11-27(32)29-20-21-12-14-23(15-13-21)28(33)34/h16,18,21-25,30H,2-15,17,19-20H2,1H3,(H,29,32)(H,33,34) |
| InChIKey | UCZUVQLUSGALCV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|