C22H36O4 — CID 70601999
7-[(1S,2R)-2-[(E)-3-hydroxydec-1-enyl]-5-oxocyclopentyl]hept-4-enoic acid (PubChem CID 70601999) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is 7-[(1S,2R)-2-[(E)-3-hydroxydec-1-enyl]-5-oxocyclopentyl]hept-4-enoic acid.
| Compound Name | 7-[(1S,2R)-2-[(E)-3-hydroxydec-1-enyl]-5-oxocyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70601999 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 7-[(1S,2R)-2-[(E)-3-hydroxydec-1-enyl]-5-oxocyclopentyl]hept-4-enoic acid |
| SMILES | CCCCCCCC(O)/C=C/[C@H]1CCC(=O)[C@H]1CCC=CCCC(=O)O |
| InChI | InChI=1S/C22H36O4/c1-2-3-4-5-8-11-19(23)16-14-18-15-17-21(24)20(18)12-9-6-7-10-13-22(25)26/h6-7,14,16,18-20,23H,2-5,8-13,15,17H2,1H3,(H,25,26)/b7-6?,16-14+/t18-,19?,20-/m0/s1 |
| InChIKey | WMFJBWYZMHBLER-HDVWZNQKSA-N |
| XLogP | 5.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|