C28H43NO4 — CID 3808302
7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[(4-methoxyphenyl)methyl]heptanamide (PubChem CID 3808302) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is 7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[(4-methoxyphenyl)methyl]heptanamide.
| Compound Name | 7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[(4-methoxyphenyl)methyl]heptanamide |
|---|---|
| PubChem CID | 3808302 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | 7-[2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]-N-[(4-methoxyphenyl)methyl]heptanamide |
| SMILES | CCCCCC(O)C=CC1CCC(=O)C1CCCCCCC(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C28H43NO4/c1-3-4-7-10-24(30)17-15-23-16-20-27(31)26(23)11-8-5-6-9-12-28(32)29-21-22-13-18-25(33-2)19-14-22/h13-15,17-19,23-24,26,30H,3-12,16,20-21H2,1-2H3,(H,29,32) |
| InChIKey | SUHAQWYHLJGBDS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|