C35H55NO4 — CID 162907903
N-[2-[(4S)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl]-7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanamide (PubChem CID 162907903) has the molecular formula C35H55NO4 and a molecular weight of 553.83 g/mol. Its IUPAC name is N-[2-[(4S)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl]-7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanamide.
| Compound Name | N-[2-[(4S)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl]-7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanamide |
|---|---|
| PubChem CID | 162907903 |
| Molecular Formula | C35H55NO4 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.41 |
| IUPAC Name | N-[2-[(4S)-2,2-dimethyl-4-phenyloxan-4-yl]ethyl]-7-[(1R,2S)-2-[(3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanamide |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1CCC(=O)[C@@H]1CCCCCCC(=O)NCC[C@]1(c2ccccc2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C35H55NO4/c1-4-5-9-16-30(37)21-19-28-20-22-32(38)31(28)17-12-6-7-13-18-33(39)36-25-23-35(29-14-10-8-11-15-29)24-26-40-34(2,3)27-35/h8,10-11,14-15,19,21,28,30-31,37H,4-7,9,12-13,16-18,20,22-27H2,1-3H3,(H,36,39)/t28-,30+,31-,35+/m1/s1 |
| InChIKey | YNENVNHLULARPT-YHCJISTESA-N |
| XLogP | 7.45 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|