C30H51NO3 — CID 25424948
trans-(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-[7-oxo-7-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]heptyl]cyclopentan-1-one (PubChem CID 25424948) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is trans-(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-[7-oxo-7-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]heptyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-[7-oxo-7-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]heptyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 25424948 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | trans-(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2-[7-oxo-7-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]heptyl]cyclopentan-1-one |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)N1C[C@]2(C)C[C@H]1CC(C)(C)C2 |
| InChI | InChI=1S/C30H51NO3/c1-5-6-9-12-25(32)17-15-23-16-18-27(33)26(23)13-10-7-8-11-14-28(34)31-22-30(4)20-24(31)19-29(2,3)21-30/h15,17,23-26,32H,5-14,16,18-22H2,1-4H3/b17-15+/t23-,24+,25-,26+,30+/m0/s1 |
| InChIKey | AKGZGYCPEILHJF-GBSIUYNASA-N |
| XLogP | 6.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|