C20H30N2O4 — CID 59769699
4-[2-[2-[(3S)-3-hydroxyoctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid (PubChem CID 59769699) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 4-[2-[2-[(3S)-3-hydroxyoctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[(3S)-3-hydroxyoctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 59769699 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 4-[2-[2-[(3S)-3-hydroxyoctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoic acid |
| SMILES | CCCCC[C@H](O)CCN1CCC(=O)N1CCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H30N2O4/c1-2-3-4-5-18(23)11-13-21-14-12-19(24)22(21)15-10-16-6-8-17(9-7-16)20(25)26/h6-9,18,23H,2-5,10-15H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | PAVYSSGJRYCIIJ-SFHVURJKSA-N |
| XLogP | 2.71 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|