C18H25N2O4UV- — CID 59769737
methyl 4-[2-[2-(4-methoxybutyl)-5-oxopyrazolidin-1-yl]ethyl]benzoate;uranium;vanadium (PubChem CID 59769737) has the molecular formula C18H25N2O4UV- and a molecular weight of 622.38 g/mol. Its IUPAC name is methyl 4-[2-[2-(4-methoxybutyl)-5-oxopyrazolidin-1-yl]ethyl]benzoate;uranium;vanadium.
| Compound Name | methyl 4-[2-[2-(4-methoxybutyl)-5-oxopyrazolidin-1-yl]ethyl]benzoate;uranium;vanadium |
|---|---|
| PubChem CID | 59769737 |
| Molecular Formula | C18H25N2O4UV- |
| Molecular Weight | 622.38 g/mol |
| Exact Mass | 622.18 |
| IUPAC Name | methyl 4-[2-[2-(4-methoxybutyl)-5-oxopyrazolidin-1-yl]ethyl]benzoate;uranium;vanadium |
| SMILES | CO[CH-]CCCN1CCC(=O)N1CCc1ccc(C(=O)OC)cc1.[U].[V] |
| InChI | InChI=1S/C18H25N2O4.U.V/c1-23-14-4-3-11-19-12-10-17(21)20(19)13-9-15-5-7-16(8-6-15)18(22)24-2;;/h5-8,14H,3-4,9-13H2,1-2H3;;/q-1;; |
| InChIKey | FSGZWRJOKMMCBJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|