C29H50N2O4Si — CID 66888886
methyl 4-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethyloctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoate (PubChem CID 66888886) has the molecular formula C29H50N2O4Si and a molecular weight of 518.82 g/mol. Its IUPAC name is methyl 4-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethyloctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethyloctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 66888886 |
| Molecular Formula | C29H50N2O4Si |
| Molecular Weight | 518.82 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | methyl 4-[2-[2-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethyloctyl]-5-oxopyrazolidin-1-yl]ethyl]benzoate |
| SMILES | CCCCC(CC)(CCCN1CCC(=O)N1CCc1ccc(C(=O)OC)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H50N2O4Si/c1-9-11-19-29(10-2,35-36(7,8)28(3,4)5)20-12-21-30-22-18-26(32)31(30)23-17-24-13-15-25(16-14-24)27(33)34-6/h13-16H,9-12,17-23H2,1-8H3 |
| InChIKey | JJPAAKHAAXYCBG-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.82 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|