C23H31NO3 — CID 87714134
methyl 4-[2-[(2R)-2-[(1E,3E)-4-methylocta-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate (PubChem CID 87714134) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is methyl 4-[2-[(2R)-2-[(1E,3E)-4-methylocta-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[(2R)-2-[(1E,3E)-4-methylocta-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 87714134 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | methyl 4-[2-[(2R)-2-[(1E,3E)-4-methylocta-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
| SMILES | CCCC/C(C)=C/C=C/[C@H]1CCC(=O)N1CCc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-4-5-7-18(2)8-6-9-21-14-15-22(25)24(21)17-16-19-10-12-20(13-11-19)23(26)27-3/h6,8-13,21H,4-5,7,14-17H2,1-3H3/b9-6+,18-8+/t21-/m0/s1 |
| InChIKey | YNZPHWFZUHBQAW-LNDXRRDCSA-N |
| XLogP | 4.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|