C21H27NO3 — CID 87871382
methyl 4-[2-[(2R)-2-[(1E,3Z)-4-methylhexa-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate (PubChem CID 87871382) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl 4-[2-[(2R)-2-[(1E,3Z)-4-methylhexa-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[(2R)-2-[(1E,3Z)-4-methylhexa-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 87871382 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl 4-[2-[(2R)-2-[(1E,3Z)-4-methylhexa-1,3-dienyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
| SMILES | CC/C(C)=C\C=C\[C@H]1CCC(=O)N1CCc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-4-16(2)6-5-7-19-12-13-20(23)22(19)15-14-17-8-10-18(11-9-17)21(24)25-3/h5-11,19H,4,12-15H2,1-3H3/b7-5+,16-6-/t19-/m0/s1 |
| InChIKey | JZEVNQDBMFUTEH-PXYFPALWSA-N |
| XLogP | 3.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|