C22H31NO4 — CID 69247914
methyl 4-[2-[(2R)-2-[(3S)-3-hydroxy-5,5-dimethylhex-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate (PubChem CID 69247914) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is methyl 4-[2-[(2R)-2-[(3S)-3-hydroxy-5,5-dimethylhex-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[(2R)-2-[(3S)-3-hydroxy-5,5-dimethylhex-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 69247914 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | methyl 4-[2-[(2R)-2-[(3S)-3-hydroxy-5,5-dimethylhex-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCN2C(=O)CC[C@@H]2C=C[C@@H](O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31NO4/c1-22(2,3)15-19(24)11-9-18-10-12-20(25)23(18)14-13-16-5-7-17(8-6-16)21(26)27-4/h5-9,11,18-19,24H,10,12-15H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | CFUUBBFXYPUSCA-RBUKOAKNSA-N |
| XLogP | 3.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|