C24H24O7 — CID 70577341
2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid (PubChem CID 70577341) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70577341 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@H]1[C@H](C=CC(=O)COc2ccccc2)[C@@H](OC(=O)c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C24H24O7/c25-17(15-30-18-9-5-2-6-10-18)11-12-19-20(13-23(27)28)21(26)14-22(19)31-24(29)16-7-3-1-4-8-16/h1-12,19-22,26H,13-15H2,(H,27,28)/t19-,20-,21+,22-/m0/s1 |
| InChIKey | CWHWXYFFZKHVPP-KJJMTIBFSA-N |
| XLogP | 2.89 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|