C17H20O6 — CID 22791957
2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid (PubChem CID 22791957) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 22791957 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-[(1S,2S,3S,5R)-3,5-dihydroxy-2-(3-oxo-4-phenoxybut-1-enyl)cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@H]1[C@H](C=CC(=O)COc2ccccc2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H20O6/c18-11(10-23-12-4-2-1-3-5-12)6-7-13-14(8-17(21)22)16(20)9-15(13)19/h1-7,13-16,19-20H,8-10H2,(H,21,22)/t13-,14-,15-,16+/m0/s1 |
| InChIKey | BRYJKYLJLPTMPM-YHUYYLMFSA-N |
| XLogP | 1.02 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|