C18H20O4 — CID 59878870
(3aR,4R,5R,6aS)-5-methyl-4-[(E)-3-oxo-4-phenoxybut-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 59878870) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-methyl-4-[(E)-3-oxo-4-phenoxybut-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-methyl-4-[(E)-3-oxo-4-phenoxybut-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 59878870 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-methyl-4-[(E)-3-oxo-4-phenoxybut-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1/C=C/C(=O)COc1ccccc1 |
| InChI | InChI=1S/C18H20O4/c1-12-9-17-16(10-18(20)22-17)15(12)8-7-13(19)11-21-14-5-3-2-4-6-14/h2-8,12,15-17H,9-11H2,1H3/b8-7+/t12-,15+,16-,17+/m1/s1 |
| InChIKey | PSTAVFUOLDFROM-JIFDRLEHSA-N |
| XLogP | 2.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|