C20H19F3O4 — CID 143233840
(3aR,4R,6aS)-5-ethenyl-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 143233840) has the molecular formula C20H19F3O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is (3aR,4R,6aS)-5-ethenyl-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,6aS)-5-ethenyl-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 143233840 |
| Molecular Formula | C20H19F3O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (3aR,4R,6aS)-5-ethenyl-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C=CC1C[C@@H]2OC(=O)C[C@@H]2[C@@H]1/C=C/C(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3O4/c1-2-12-8-18-17(10-19(25)27-18)16(12)7-6-14(24)11-26-15-5-3-4-13(9-15)20(21,22)23/h2-7,9,12,16-18H,1,8,10-11H2/b7-6+/t12?,16-,17-,18+/m1/s1 |
| InChIKey | PRRIEWSRODDHCV-PJRIIDFBSA-N |
| XLogP | 3.96 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|