C20H23F3O2 — CID 143889221
(E)-4-[(2R)-2-[(Z)-but-2-enyl]cyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-one (PubChem CID 143889221) has the molecular formula C20H23F3O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is (E)-4-[(2R)-2-[(Z)-but-2-enyl]cyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-one.
| Compound Name | (E)-4-[(2R)-2-[(Z)-but-2-enyl]cyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-one |
|---|---|
| PubChem CID | 143889221 |
| Molecular Formula | C20H23F3O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (E)-4-[(2R)-2-[(Z)-but-2-enyl]cyclopentyl]-1-[3-(trifluoromethyl)phenoxy]but-3-en-2-one |
| SMILES | C/C=C\C[C@H]1CCCC1/C=C/C(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H23F3O2/c1-2-3-6-15-7-4-8-16(15)11-12-18(24)14-25-19-10-5-9-17(13-19)20(21,22)23/h2-3,5,9-13,15-16H,4,6-8,14H2,1H3/b3-2-,12-11+/t15-,16?/m0/s1 |
| InChIKey | RYLVMEREKWAYTI-YHXKYFSKSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|