C26H33F3O7 — CID 155669645
propan-2-yl 4-[3-[[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]methyl]oxiran-2-yl]butanoate (PubChem CID 155669645) has the molecular formula C26H33F3O7 and a molecular weight of 514.54 g/mol. Its IUPAC name is propan-2-yl 4-[3-[[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]methyl]oxiran-2-yl]butanoate.
| Compound Name | propan-2-yl 4-[3-[[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]methyl]oxiran-2-yl]butanoate |
|---|---|
| PubChem CID | 155669645 |
| Molecular Formula | C26H33F3O7 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | propan-2-yl 4-[3-[[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]methyl]oxiran-2-yl]butanoate |
| SMILES | CC(C)OC(=O)CCCC1OC1C[C@@H]1[C@@H](/C=C/C(=O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H33F3O7/c1-15(2)35-25(33)8-4-7-23-24(36-23)12-20-19(21(31)13-22(20)32)10-9-17(30)14-34-18-6-3-5-16(11-18)26(27,28)29/h3,5-6,9-11,15,19-24,31-32H,4,7-8,12-14H2,1-2H3/b10-9+/t19-,20-,21-,22+,23?,24?/m1/s1 |
| InChIKey | YUXYBLUWOMKBDO-SRKDRLBJSA-N |
| XLogP | 3.85 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|