C24H23ClO7 — CID 88809359
2-[(1R,2S,3R,5S)-3-benzoyloxy-2-(2-chloro-3-oxo-4-phenoxybut-1-enyl)-5-hydroxycyclopentyl]acetic acid (PubChem CID 88809359) has the molecular formula C24H23ClO7 and a molecular weight of 458.89 g/mol. Its IUPAC name is 2-[(1R,2S,3R,5S)-3-benzoyloxy-2-(2-chloro-3-oxo-4-phenoxybut-1-enyl)-5-hydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2S,3R,5S)-3-benzoyloxy-2-(2-chloro-3-oxo-4-phenoxybut-1-enyl)-5-hydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 88809359 |
| Molecular Formula | C24H23ClO7 |
| Molecular Weight | 458.89 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-[(1R,2S,3R,5S)-3-benzoyloxy-2-(2-chloro-3-oxo-4-phenoxybut-1-enyl)-5-hydroxycyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@@H]1[C@@H](C=C(Cl)C(=O)COc2ccccc2)[C@H](OC(=O)c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C24H23ClO7/c25-19(21(27)14-31-16-9-5-2-6-10-16)11-18-17(12-23(28)29)20(26)13-22(18)32-24(30)15-7-3-1-4-8-15/h1-11,17-18,20,22,26H,12-14H2,(H,28,29)/t17-,18-,20+,22-/m1/s1 |
| InChIKey | RREVTAOGPXZXHZ-HROGELHOSA-N |
| XLogP | 3.45 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|