C21H20O6 — CID 22789639
2-[(1R,2R,3R,5S)-2-formyl-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid (PubChem CID 22789639) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-2-formyl-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-2-formyl-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 22789639 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-2-formyl-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
| SMILES | O=C[C@@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@H]1OC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20O6/c22-12-17-16(10-20(24)25)18(23)11-19(17)27-21(26)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-9,12,16-19,23H,10-11H2,(H,24,25)/t16-,17-,18+,19-/m1/s1 |
| InChIKey | LIROXDUJXBHUGO-AKHDSKFASA-N |
| XLogP | 2.55 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|