C28H29NO6 — CID 70619509
2-[2-(7-cyano-3-oxohept-1-enyl)-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid (PubChem CID 70619509) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is 2-[2-(7-cyano-3-oxohept-1-enyl)-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid.
| Compound Name | 2-[2-(7-cyano-3-oxohept-1-enyl)-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70619509 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-[2-(7-cyano-3-oxohept-1-enyl)-5-hydroxy-3-(4-phenylbenzoyl)oxycyclopentyl]acetic acid |
| SMILES | N#CCCCCC(=O)C=CC1C(OC(=O)c2ccc(-c3ccccc3)cc2)CC(O)C1CC(=O)O |
| InChI | InChI=1S/C28H29NO6/c29-16-6-2-5-9-22(30)14-15-23-24(17-27(32)33)25(31)18-26(23)35-28(34)21-12-10-20(11-13-21)19-7-3-1-4-8-19/h1,3-4,7-8,10-15,23-26,31H,2,5-6,9,17-18H2,(H,32,33) |
| InChIKey | LMGFKEVKGWLOAN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|