C30H34O8 — CID 70591860
2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-[5-[2-(oxan-2-yloxy)phenyl]-3-oxopent-1-enyl]cyclopentyl]acetic acid (PubChem CID 70591860) has the molecular formula C30H34O8 and a molecular weight of 522.59 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-[5-[2-(oxan-2-yloxy)phenyl]-3-oxopent-1-enyl]cyclopentyl]acetic acid.
| Compound Name | 2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-[5-[2-(oxan-2-yloxy)phenyl]-3-oxopent-1-enyl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 70591860 |
| Molecular Formula | C30H34O8 |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 2-[(1S,2S,3S,5R)-3-benzoyloxy-5-hydroxy-2-[5-[2-(oxan-2-yloxy)phenyl]-3-oxopent-1-enyl]cyclopentyl]acetic acid |
| SMILES | O=C(O)C[C@H]1[C@H](C=CC(=O)CCc2ccccc2OC2CCCCO2)[C@@H](OC(=O)c2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C30H34O8/c31-22(14-13-20-8-4-5-11-26(20)37-29-12-6-7-17-36-29)15-16-23-24(18-28(33)34)25(32)19-27(23)38-30(35)21-9-2-1-3-10-21/h1-5,8-11,15-16,23-25,27,29,32H,6-7,12-14,17-19H2,(H,33,34)/t23-,24-,25+,27-,29?/m0/s1 |
| InChIKey | FJJKBTHCOAQRJX-WUSXCGPQSA-N |
| XLogP | 4.35 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|